C15H14O8 — CID 102576860
methyl (3aS,8aR,8bR)-7-(2-methoxy-2-oxoethyl)-1,3-dioxo-3a,4,8a,8b-tetrahydrofuro[3,4-e][1]benzofuran-8-carboxylate (PubChem CID 102576860) has the molecular formula C15H14O8 and a molecular weight of 322.27 g/mol. Its IUPAC name is methyl (3aS,8aR,8bR)-7-(2-methoxy-2-oxoethyl)-1,3-dioxo-3a,4,8a,8b-tetrahydrofuro[3,4-e][1]benzofuran-8-carboxylate.
| Compound Name | methyl (3aS,8aR,8bR)-7-(2-methoxy-2-oxoethyl)-1,3-dioxo-3a,4,8a,8b-tetrahydrofuro[3,4-e][1]benzofuran-8-carboxylate |
|---|---|
| PubChem CID | 102576860 |
| Molecular Formula | C15H14O8 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | methyl (3aS,8aR,8bR)-7-(2-methoxy-2-oxoethyl)-1,3-dioxo-3a,4,8a,8b-tetrahydrofuro[3,4-e][1]benzofuran-8-carboxylate |
| SMILES | COC(=O)CC1=C(C(=O)OC)[C@@H]2C(=CC[C@@H]3C(=O)OC(=O)[C@H]23)O1 |
| InChI | InChI=1S/C15H14O8/c1-20-9(16)5-8-12(14(18)21-2)11-7(22-8)4-3-6-10(11)15(19)23-13(6)17/h4,6,10-11H,3,5H2,1-2H3/t6-,10-,11+/m0/s1 |
| InChIKey | DYPNBEDVMBBKPP-NRZXQICZSA-N |
| XLogP | 0.23 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|