C10H10O5 — CID 10703630
methyl (3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-5-carboxylate (PubChem CID 10703630) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is methyl (3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-5-carboxylate.
| Compound Name | methyl (3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 10703630 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | methyl (3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-5-carboxylate |
| SMILES | COC(=O)C1=CC[C@H]2C(=O)OC(=O)[C@H]2C1 |
| InChI | InChI=1S/C10H10O5/c1-14-8(11)5-2-3-6-7(4-5)10(13)15-9(6)12/h2,6-7H,3-4H2,1H3/t6-,7+/m1/s1 |
| InChIKey | MOXFYKOSUKCXRW-RQJHMYQMSA-N |
| XLogP | 0.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|