C11H8O7 — CID 71675997
methyl 3,5,9-trioxo-4,8-dioxatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate (PubChem CID 71675997) has the molecular formula C11H8O7 and a molecular weight of 252.18 g/mol. Its IUPAC name is methyl 3,5,9-trioxo-4,8-dioxatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate.
| Compound Name | methyl 3,5,9-trioxo-4,8-dioxatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate |
|---|---|
| PubChem CID | 71675997 |
| Molecular Formula | C11H8O7 |
| Molecular Weight | 252.18 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | methyl 3,5,9-trioxo-4,8-dioxatricyclo[5.2.2.02,6]undec-10-ene-11-carboxylate |
| SMILES | COC(=O)C1=CC2C(=O)OC1C1C(=O)OC(=O)C21 |
| InChI | InChI=1S/C11H8O7/c1-16-8(12)4-2-3-5-6(7(4)17-9(3)13)11(15)18-10(5)14/h2-3,5-7H,1H3 |
| InChIKey | QYKMDQHVKBEGRQ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.18 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|