C12H12O7 — CID 10563794
dimethyl (3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-4,5-dicarboxylate (PubChem CID 10563794) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is dimethyl (3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-4,5-dicarboxylate.
| Compound Name | dimethyl (3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10563794 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | dimethyl (3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-2-benzofuran-4,5-dicarboxylate |
| SMILES | COC(=O)C1=CC[C@H]2C(=O)OC(=O)[C@H]2C1C(=O)OC |
| InChI | InChI=1S/C12H12O7/c1-17-9(13)5-3-4-6-8(7(5)11(15)18-2)12(16)19-10(6)14/h3,6-8H,4H2,1-2H3/t6-,7?,8-/m1/s1 |
| InChIKey | SLAZKESKFCENAT-OECOWPMFSA-N |
| XLogP | -0.41 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|