C16H22O4 — CID 10850220
ethyl (3S,3aR,4R,4aS,8aS)-3-methyl-1-oxo-3a,4,4a,5,6,7,8,8a-octahydro-3H-benzo[f][2]benzofuran-4-carboxylate (PubChem CID 10850220) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is ethyl (3S,3aR,4R,4aS,8aS)-3-methyl-1-oxo-3a,4,4a,5,6,7,8,8a-octahydro-3H-benzo[f][2]benzofuran-4-carboxylate.
| Compound Name | ethyl (3S,3aR,4R,4aS,8aS)-3-methyl-1-oxo-3a,4,4a,5,6,7,8,8a-octahydro-3H-benzo[f][2]benzofuran-4-carboxylate |
|---|---|
| PubChem CID | 10850220 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | ethyl (3S,3aR,4R,4aS,8aS)-3-methyl-1-oxo-3a,4,4a,5,6,7,8,8a-octahydro-3H-benzo[f][2]benzofuran-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2CCCC[C@@H]2C=C2C(=O)O[C@@H](C)[C@@H]21 |
| InChI | InChI=1S/C16H22O4/c1-3-19-16(18)14-11-7-5-4-6-10(11)8-12-13(14)9(2)20-15(12)17/h8-11,13-14H,3-7H2,1-2H3/t9-,10+,11-,13-,14+/m0/s1 |
| InChIKey | SWOIVYYZGZHORL-GGFUIZRSSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |