C39H42N4O5 — CID 102596054
7-phenylmethoxy-3,11,17,28-tetrazatetracyclo[27.2.2.213,16.15,9]hexatriaconta-1(32),5(36),6,8,13,15,29(33),30,34-nonaene-4,10,18,27-tetrone (PubChem CID 102596054) has the molecular formula C39H42N4O5 and a molecular weight of 646.79 g/mol. Its IUPAC name is 7-phenylmethoxy-3,11,17,28-tetrazatetracyclo[27.2.2.213,16.15,9]hexatriaconta-1(32),5(36),6,8,13,15,29(33),30,34-nonaene-4,10,18,27-tetrone.
| Compound Name | 7-phenylmethoxy-3,11,17,28-tetrazatetracyclo[27.2.2.213,16.15,9]hexatriaconta-1(32),5(36),6,8,13,15,29(33),30,34-nonaene-4,10,18,27-tetrone |
|---|---|
| PubChem CID | 102596054 |
| Molecular Formula | C39H42N4O5 |
| Molecular Weight | 646.79 g/mol |
| Exact Mass | 646.32 |
| IUPAC Name | 7-phenylmethoxy-3,11,17,28-tetrazatetracyclo[27.2.2.213,16.15,9]hexatriaconta-1(32),5(36),6,8,13,15,29(33),30,34-nonaene-4,10,18,27-tetrone |
| SMILES | O=C1CCCCCCCCC(=O)Nc2ccc(cc2)CNC(=O)c2cc(OCc3ccccc3)cc(c2)C(=O)NCc2ccc(cc2)N1 |
| InChI | InChI=1S/C39H42N4O5/c44-36-12-8-3-1-2-4-9-13-37(45)43-34-20-16-29(17-21-34)26-41-39(47)32-22-31(23-35(24-32)48-27-30-10-6-5-7-11-30)38(46)40-25-28-14-18-33(42-36)19-15-28/h5-7,10-11,14-24H,1-4,8-9,12-13,25-27H2,(H,40,46)(H,41,47)(H,42,44)(H,43,45) |
| InChIKey | KSMLRSWLNCIGQJ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.79 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |