C17H25N3O3 — CID 102597293
N-(2,2-dimethoxyethyl)-3-(1H-indol-3-yl)-N-methyl-2-(methylamino)propanamide (PubChem CID 102597293) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-(1H-indol-3-yl)-N-methyl-2-(methylamino)propanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3-(1H-indol-3-yl)-N-methyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 102597293 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-(1H-indol-3-yl)-N-methyl-2-(methylamino)propanamide |
| SMILES | CNC(Cc1c[nH]c2ccccc12)C(=O)N(C)CC(OC)OC |
| InChI | InChI=1S/C17H25N3O3/c1-18-15(17(21)20(2)11-16(22-3)23-4)9-12-10-19-14-8-6-5-7-13(12)14/h5-8,10,15-16,18-19H,9,11H2,1-4H3 |
| InChIKey | JENJQVZPSDDBCV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|