C15H22O3 — CID 102598419
methyl (1S,2R,5S,6S)-6,8,8-trimethyl-10-oxotricyclo[4.4.0.02,5]decane-2-carboxylate (PubChem CID 102598419) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (1S,2R,5S,6S)-6,8,8-trimethyl-10-oxotricyclo[4.4.0.02,5]decane-2-carboxylate.
| Compound Name | methyl (1S,2R,5S,6S)-6,8,8-trimethyl-10-oxotricyclo[4.4.0.02,5]decane-2-carboxylate |
|---|---|
| PubChem CID | 102598419 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (1S,2R,5S,6S)-6,8,8-trimethyl-10-oxotricyclo[4.4.0.02,5]decane-2-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@H]1[C@]1(C)CC(C)(C)CC(=O)[C@@H]12 |
| InChI | InChI=1S/C15H22O3/c1-13(2)7-9(16)11-14(3,8-13)10-5-6-15(10,11)12(17)18-4/h10-11H,5-8H2,1-4H3/t10-,11-,14-,15+/m0/s1 |
| InChIKey | JHNAOMKUTRISLN-LWWSYDQCSA-N |
| XLogP | 2.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |