C11H16O4 — CID 102598595
methyl (3R,3aR,4R,7aR)-4-methyl-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-3-carboxylate (PubChem CID 102598595) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is methyl (3R,3aR,4R,7aR)-4-methyl-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-3-carboxylate.
| Compound Name | methyl (3R,3aR,4R,7aR)-4-methyl-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 102598595 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | methyl (3R,3aR,4R,7aR)-4-methyl-2-oxo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-3-carboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)O[C@@H]2CCC[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C11H16O4/c1-6-4-3-5-7-8(6)9(10(12)14-2)11(13)15-7/h6-9H,3-5H2,1-2H3/t6-,7-,8+,9-/m1/s1 |
| InChIKey | CCUSGWMWTXDXBD-LURQLKTLSA-N |
| XLogP | 1.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|