C21H27NO8S — CID 102598702
[(2R,3S,4R,5R,6S)-5-(N-acetyl-4-methylanilino)-3,4-diacetyloxy-6-sulfanyloxan-2-yl]methyl acetate (PubChem CID 102598702) has the molecular formula C21H27NO8S and a molecular weight of 453.51 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-(N-acetyl-4-methylanilino)-3,4-diacetyloxy-6-sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-(N-acetyl-4-methylanilino)-3,4-diacetyloxy-6-sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102598702 |
| Molecular Formula | C21H27NO8S |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-(N-acetyl-4-methylanilino)-3,4-diacetyloxy-6-sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S)[C@H](N(C(C)=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H27NO8S/c1-11-6-8-16(9-7-11)22(12(2)23)18-20(29-15(5)26)19(28-14(4)25)17(30-21(18)31)10-27-13(3)24/h6-9,17-21,31H,10H2,1-5H3/t17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | KCNLCAUTIXKOOZ-ONUIULTDSA-N |
| XLogP | 1.80 |
| TPSA | 108.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|