C19H14N2O — CID 102599004
8-methyl-3-phenyl-2H-benzo[b][1,6]naphthyridin-1-one (PubChem CID 102599004) has the molecular formula C19H14N2O and a molecular weight of 286.33 g/mol. Its IUPAC name is 8-methyl-3-phenyl-2H-benzo[b][1,6]naphthyridin-1-one.
| Compound Name | 8-methyl-3-phenyl-2H-benzo[b][1,6]naphthyridin-1-one |
|---|---|
| PubChem CID | 102599004 |
| Molecular Formula | C19H14N2O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 8-methyl-3-phenyl-2H-benzo[b][1,6]naphthyridin-1-one |
| SMILES | Cc1ccc2nc3cc(-c4ccccc4)[nH]c(=O)c3cc2c1 |
| InChI | InChI=1S/C19H14N2O/c1-12-7-8-16-14(9-12)10-15-18(20-16)11-17(21-19(15)22)13-5-3-2-4-6-13/h2-11H,1H3,(H,21,22) |
| InChIKey | SIDGDSATBHWQOG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|