C15H26O2 — CID 102599722
(3E,6E,8E)-4,6-dimethyltrideca-3,6,8-triene-1,13-diol (PubChem CID 102599722) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (3E,6E,8E)-4,6-dimethyltrideca-3,6,8-triene-1,13-diol.
| Compound Name | (3E,6E,8E)-4,6-dimethyltrideca-3,6,8-triene-1,13-diol |
|---|---|
| PubChem CID | 102599722 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (3E,6E,8E)-4,6-dimethyltrideca-3,6,8-triene-1,13-diol |
| SMILES | C/C(=C\C=C\CCCCO)C/C(C)=C/CCO |
| InChI | InChI=1S/C15H26O2/c1-14(13-15(2)10-8-12-17)9-6-4-3-5-7-11-16/h4,6,9-10,16-17H,3,5,7-8,11-13H2,1-2H3/b6-4+,14-9+,15-10+ |
| InChIKey | YUQVGCHUPFDGNN-GDYBBUEGSA-N |
| XLogP | 3.37 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|