C36H24N2O2 — CID 102599851
2-(N-naphthalen-2-ylanilino)-4-[naphthalen-2-yl(phenyl)azaniumylidene]-3-oxocyclobuten-1-olate (PubChem CID 102599851) has the molecular formula C36H24N2O2 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-(N-naphthalen-2-ylanilino)-4-[naphthalen-2-yl(phenyl)azaniumylidene]-3-oxocyclobuten-1-olate.
| Compound Name | 2-(N-naphthalen-2-ylanilino)-4-[naphthalen-2-yl(phenyl)azaniumylidene]-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 102599851 |
| Molecular Formula | C36H24N2O2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | 2-(N-naphthalen-2-ylanilino)-4-[naphthalen-2-yl(phenyl)azaniumylidene]-3-oxocyclobuten-1-olate |
| SMILES | O=c1c(N(c2ccccc2)c2ccc3ccccc3c2)c([O-])/c1=[N+](\c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C36H24N2O2/c39-35-33(37(29-15-3-1-4-16-29)31-21-19-25-11-7-9-13-27(25)23-31)36(40)34(35)38(30-17-5-2-6-18-30)32-22-20-26-12-8-10-14-28(26)24-32/h1-24H |
| InChIKey | RQOJXRTVNMTETK-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|