C56H36N2O6 — CID 137295891
2-[4-(dinaphthalen-2-ylamino)-2,6-dihydroxyphenyl]-4-(4-dinaphthalen-2-ylazaniumylidene-2,6-dihydroxycyclohexa-2,5-dien-1-ylidene)-3-oxocyclobuten-1-olate (PubChem CID 137295891) has the molecular formula C56H36N2O6 and a molecular weight of 832.91 g/mol. Its IUPAC name is 2-[4-(dinaphthalen-2-ylamino)-2,6-dihydroxyphenyl]-4-(4-dinaphthalen-2-ylazaniumylidene-2,6-dihydroxycyclohexa-2,5-dien-1-ylidene)-3-oxocyclobuten-1-olate.
| Compound Name | 2-[4-(dinaphthalen-2-ylamino)-2,6-dihydroxyphenyl]-4-(4-dinaphthalen-2-ylazaniumylidene-2,6-dihydroxycyclohexa-2,5-dien-1-ylidene)-3-oxocyclobuten-1-olate |
|---|---|
| PubChem CID | 137295891 |
| Molecular Formula | C56H36N2O6 |
| Molecular Weight | 832.91 g/mol |
| Exact Mass | 832.26 |
| IUPAC Name | 2-[4-(dinaphthalen-2-ylamino)-2,6-dihydroxyphenyl]-4-(4-dinaphthalen-2-ylazaniumylidene-2,6-dihydroxycyclohexa-2,5-dien-1-ylidene)-3-oxocyclobuten-1-olate |
| SMILES | O=C1C(=C2C(O)=CC(=[N+](c3ccc4ccccc4c3)c3ccc4ccccc4c3)C=C2O)C([O-])=C1c1c(O)cc(N(c2ccc3ccccc3c2)c2ccc3ccccc3c2)cc1O |
| InChI | InChI=1S/C56H36N2O6/c59-47-29-45(57(41-21-17-33-9-1-5-13-37(33)25-41)42-22-18-34-10-2-6-14-38(34)26-42)30-48(60)51(47)53-55(63)54(56(53)64)52-49(61)31-46(32-50(52)62)58(43-23-19-35-11-3-7-15-39(35)27-43)44-24-20-36-12-4-8-16-40(36)28-44/h1-32H,(H4,59,60,61,62,63,64) |
| InChIKey | FOKCPLISJNRWNA-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 127.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.91 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|