C49H35N2O3+ — CID 165043219
[(4E)-3-hydroxy-4-[3-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]-2-methyl-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-naphthalen-1-yl-phenylazanium (PubChem CID 165043219) has the molecular formula C49H35N2O3+ and a molecular weight of 699.83 g/mol. Its IUPAC name is [(4E)-3-hydroxy-4-[3-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]-2-methyl-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-naphthalen-1-yl-phenylazanium.
| Compound Name | [(4E)-3-hydroxy-4-[3-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]-2-methyl-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-naphthalen-1-yl-phenylazanium |
|---|---|
| PubChem CID | 165043219 |
| Molecular Formula | C49H35N2O3+ |
| Molecular Weight | 699.83 g/mol |
| Exact Mass | 699.26 |
| IUPAC Name | [(4E)-3-hydroxy-4-[3-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]-2-methyl-4-oxocyclobut-2-en-1-ylidene]cyclohexa-2,5-dien-1-ylidene]-naphthalen-1-yl-phenylazanium |
| SMILES | CC1=C(c2ccc(N(c3ccccc3)c3cccc4ccccc34)cc2O)C(=O)/C1=C1\C=C/C(=[N+](/c2ccccc2)c2cccc3ccccc23)C=C1O |
| InChI | InChI=1S/C49H34N2O3/c1-32-47(41-28-26-37(30-45(41)52)50(35-18-4-2-5-19-35)43-24-12-16-33-14-8-10-22-39(33)43)49(54)48(32)42-29-27-38(31-46(42)53)51(36-20-6-3-7-21-36)44-25-13-17-34-15-9-11-23-40(34)44/h2-31H,1H3,(H,52,53)/p+1 |
| InChIKey | OLZVDBQYSPGCKN-UHFFFAOYSA-O |
| XLogP | 11.81 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.83 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|