C53H37N2O3+ — CID 160508006
[(4E)-3-hydroxy-4-[3-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]-2-methyl-4-oxocyclobut-2-en-1-ylidene]naphthalen-1-ylidene]-naphthalen-1-yl-phenylazanium (PubChem CID 160508006) has the molecular formula C53H37N2O3+ and a molecular weight of 749.89 g/mol. Its IUPAC name is [(4E)-3-hydroxy-4-[3-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]-2-methyl-4-oxocyclobut-2-en-1-ylidene]naphthalen-1-ylidene]-naphthalen-1-yl-phenylazanium.
| Compound Name | [(4E)-3-hydroxy-4-[3-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]-2-methyl-4-oxocyclobut-2-en-1-ylidene]naphthalen-1-ylidene]-naphthalen-1-yl-phenylazanium |
|---|---|
| PubChem CID | 160508006 |
| Molecular Formula | C53H37N2O3+ |
| Molecular Weight | 749.89 g/mol |
| Exact Mass | 749.28 |
| IUPAC Name | [(4E)-3-hydroxy-4-[3-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]-2-methyl-4-oxocyclobut-2-en-1-ylidene]naphthalen-1-ylidene]-naphthalen-1-yl-phenylazanium |
| SMILES | CC1=C(c2ccc(N(c3ccccc3)c3cccc4ccccc34)cc2O)C(=O)/C1=C1/C(O)=C/C(=[N+](/c2ccccc2)c2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C53H36N2O3/c1-34-50(44-31-30-39(32-48(44)56)54(37-20-4-2-5-21-37)45-28-14-18-35-16-8-10-24-40(35)45)53(58)51(34)52-43-27-13-12-26-42(43)47(33-49(52)57)55(38-22-6-3-7-23-38)46-29-15-19-36-17-9-11-25-41(36)46/h2-33H,1H3,(H,56,57)/p+1 |
| InChIKey | BAEHIERHNXCVIG-UHFFFAOYSA-O |
| XLogP | 12.76 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.89 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|