C32H21NO3 — CID 175154883
2-[[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]methylidene]indene-1,3-dione (PubChem CID 175154883) has the molecular formula C32H21NO3 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]methylidene]indene-1,3-dione.
| Compound Name | 2-[[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 175154883 |
| Molecular Formula | C32H21NO3 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 2-[[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(N(c3ccccc3)c3cccc4ccccc34)cc2O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C32H21NO3/c34-30-20-24(18-17-22(30)19-28-31(35)26-14-6-7-15-27(26)32(28)36)33(23-11-2-1-3-12-23)29-16-8-10-21-9-4-5-13-25(21)29/h1-20,34H |
| InChIKey | HEXOBOXULPYHHK-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|