C26H17NO4 — CID 155377409
3-hydroxy-4-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]cyclobut-3-ene-1,2-dione (PubChem CID 155377409) has the molecular formula C26H17NO4 and a molecular weight of 407.43 g/mol. Its IUPAC name is 3-hydroxy-4-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-hydroxy-4-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 155377409 |
| Molecular Formula | C26H17NO4 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-hydroxy-4-[2-hydroxy-4-(N-naphthalen-1-ylanilino)phenyl]cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(O)c(-c2ccc(N(c3ccccc3)c3cccc4ccccc34)cc2O)c1=O |
| InChI | InChI=1S/C26H17NO4/c28-22-15-18(13-14-20(22)23-24(29)26(31)25(23)30)27(17-9-2-1-3-10-17)21-12-6-8-16-7-4-5-11-19(16)21/h1-15,28-29H |
| InChIKey | MJAKTNPOUADMQA-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|