C16H18ClN3O2 — CID 102604353
[2-[(4-chlorophenyl)methyl]morpholin-4-yl]-(1-methylimidazol-2-yl)methanone (PubChem CID 102604353) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methyl]morpholin-4-yl]-(1-methylimidazol-2-yl)methanone.
| Compound Name | [2-[(4-chlorophenyl)methyl]morpholin-4-yl]-(1-methylimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 102604353 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | [2-[(4-chlorophenyl)methyl]morpholin-4-yl]-(1-methylimidazol-2-yl)methanone |
| SMILES | Cn1ccnc1C(=O)N1CCOC(Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-19-7-6-18-15(19)16(21)20-8-9-22-14(11-20)10-12-2-4-13(17)5-3-12/h2-7,14H,8-11H2,1H3 |
| InChIKey | XYMUUIBWMVSITI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |