C11H15N7O2 — CID 157014614
(1-methylimidazol-2-yl)-[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methanone (PubChem CID 157014614) has the molecular formula C11H15N7O2 and a molecular weight of 277.29 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methanone.
| Compound Name | (1-methylimidazol-2-yl)-[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 157014614 |
| Molecular Formula | C11H15N7O2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (1-methylimidazol-2-yl)-[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methanone |
| SMILES | Cn1nnc(C2CN(C(=O)c3nccn3C)CCO2)n1 |
| InChI | InChI=1S/C11H15N7O2/c1-16-4-3-12-10(16)11(19)18-5-6-20-8(7-18)9-13-15-17(2)14-9/h3-4,8H,5-7H2,1-2H3 |
| InChIKey | KPVVGUKPKBIFKQ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 90.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |