C13H22N6O3 — CID 157014071
(4-methoxypiperidin-4-yl)-[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methanone (PubChem CID 157014071) has the molecular formula C13H22N6O3 and a molecular weight of 310.36 g/mol. Its IUPAC name is (4-methoxypiperidin-4-yl)-[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methanone.
| Compound Name | (4-methoxypiperidin-4-yl)-[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 157014071 |
| Molecular Formula | C13H22N6O3 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (4-methoxypiperidin-4-yl)-[2-(2-methyltetrazol-5-yl)morpholin-4-yl]methanone |
| SMILES | COC1(C(=O)N2CCOC(c3nnn(C)n3)C2)CCNCC1 |
| InChI | InChI=1S/C13H22N6O3/c1-18-16-11(15-17-18)10-9-19(7-8-22-10)12(20)13(21-2)3-5-14-6-4-13/h10,14H,3-9H2,1-2H3 |
| InChIKey | KLADFDCUIGRPQX-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |