C12H17NO4S — CID 102605751
[3-[2-(oxetan-3-yloxy)ethylsulfonyl]phenyl]methanamine (PubChem CID 102605751) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is [3-[2-(oxetan-3-yloxy)ethylsulfonyl]phenyl]methanamine.
| Compound Name | [3-[2-(oxetan-3-yloxy)ethylsulfonyl]phenyl]methanamine |
|---|---|
| PubChem CID | 102605751 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [3-[2-(oxetan-3-yloxy)ethylsulfonyl]phenyl]methanamine |
| SMILES | NCc1cccc(S(=O)(=O)CCOC2COC2)c1 |
| InChI | InChI=1S/C12H17NO4S/c13-7-10-2-1-3-12(6-10)18(14,15)5-4-17-11-8-16-9-11/h1-3,6,11H,4-5,7-9,13H2 |
| InChIKey | LVHYATMEQXQVGN-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |