5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid

C9H13N3O4 — CID 102606443

IUPAC5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid
SMILESO=C(O)CCCC(=O)NCCc1ncno1
InChIInChI=1S/C9H13N3O4/c13-7(2-1-3-9(14)15)10-5-4-8-11-6-12-16-8/h6H,1-5H2,(H,10,13)(H,14,15)
InChIKeyPJINEYNHTMMFDC-UHFFFAOYSA-N
MW227.22 g/mol
LogP-0.02
Rot. Bonds7

About 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid

5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid (PubChem CID 102606443) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid.

Molecular Properties

Compound Name5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid
PubChem CID102606443
Molecular FormulaC9H13N3O4
Molecular Weight227.22 g/mol
Exact Mass227.09
IUPAC Name5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid
SMILESO=C(O)CCCC(=O)NCCc1ncno1
InChIInChI=1S/C9H13N3O4/c13-7(2-1-3-9(14)15)10-5-4-8-11-6-12-16-8/h6H,1-5H2,(H,10,13)(H,14,15)
InChIKeyPJINEYNHTMMFDC-UHFFFAOYSA-N
XLogP-0.02
TPSA105.32 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 5-0.02
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid?
The IUPAC name of 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid (CID 102606443) is 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid.
What is the SMILES notation for 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid?
The canonical SMILES for 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid is O=C(O)CCCC(=O)NCCc1ncno1.
What is the InChIKey of 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid?
The InChIKey is PJINEYNHTMMFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c13-7(2-1-3-9(14)15)10-5-4-8-11-6-12-16-8/h6H,1-5H2,(H,10,13)(H,14,15).
What are the key properties of 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid?
5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid has a molecular weight of 227.22 g/mol, XLogP of -0.02, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid is sourced from PubChem (CID 102606443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).