C9H13N3O4 — CID 102606443
5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid (PubChem CID 102606443) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid.
| Compound Name | 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 102606443 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 5-[2-(1,2,4-oxadiazol-5-yl)ethylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCCc1ncno1 |
| InChI | InChI=1S/C9H13N3O4/c13-7(2-1-3-9(14)15)10-5-4-8-11-6-12-16-8/h6H,1-5H2,(H,10,13)(H,14,15) |
| InChIKey | PJINEYNHTMMFDC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |