C9H13N3O2 — CID 102608806
N,5-dimethyl-6-(oxetan-3-yloxy)pyrimidin-4-amine (PubChem CID 102608806) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is N,5-dimethyl-6-(oxetan-3-yloxy)pyrimidin-4-amine.
| Compound Name | N,5-dimethyl-6-(oxetan-3-yloxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 102608806 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N,5-dimethyl-6-(oxetan-3-yloxy)pyrimidin-4-amine |
| SMILES | CNc1ncnc(OC2COC2)c1C |
| InChI | InChI=1S/C9H13N3O2/c1-6-8(10-2)11-5-12-9(6)14-7-3-13-4-7/h5,7H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | NOJFMXSVCYCNAO-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |