C11H19N3O2 — CID 80860742
N,5-dimethyl-6-(2-propan-2-yloxyethoxy)pyrimidin-4-amine (PubChem CID 80860742) has the molecular formula C11H19N3O2 and a molecular weight of 225.29 g/mol. Its IUPAC name is N,5-dimethyl-6-(2-propan-2-yloxyethoxy)pyrimidin-4-amine.
| Compound Name | N,5-dimethyl-6-(2-propan-2-yloxyethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80860742 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N,5-dimethyl-6-(2-propan-2-yloxyethoxy)pyrimidin-4-amine |
| SMILES | CNc1ncnc(OCCOC(C)C)c1C |
| InChI | InChI=1S/C11H19N3O2/c1-8(2)15-5-6-16-11-9(3)10(12-4)13-7-14-11/h7-8H,5-6H2,1-4H3,(H,12,13,14) |
| InChIKey | NHZHJTLNDFXSFJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|