C14H23N3O2 — CID 80989314
2-cyclopropyl-N,5-dimethyl-6-(2-propan-2-yloxyethoxy)pyrimidin-4-amine (PubChem CID 80989314) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-cyclopropyl-N,5-dimethyl-6-(2-propan-2-yloxyethoxy)pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N,5-dimethyl-6-(2-propan-2-yloxyethoxy)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80989314 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-cyclopropyl-N,5-dimethyl-6-(2-propan-2-yloxyethoxy)pyrimidin-4-amine |
| SMILES | CNc1nc(C2CC2)nc(OCCOC(C)C)c1C |
| InChI | InChI=1S/C14H23N3O2/c1-9(2)18-7-8-19-14-10(3)12(15-4)16-13(17-14)11-5-6-11/h9,11H,5-8H2,1-4H3,(H,15,16,17) |
| InChIKey | KCFYXKFEDMQUBW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|