C12H22N4O — CID 80871416
6-[2-(diethylamino)ethoxy]-N,5-dimethylpyrimidin-4-amine (PubChem CID 80871416) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 6-[2-(diethylamino)ethoxy]-N,5-dimethylpyrimidin-4-amine.
| Compound Name | 6-[2-(diethylamino)ethoxy]-N,5-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80871416 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 6-[2-(diethylamino)ethoxy]-N,5-dimethylpyrimidin-4-amine |
| SMILES | CCN(CC)CCOc1ncnc(NC)c1C |
| InChI | InChI=1S/C12H22N4O/c1-5-16(6-2)7-8-17-12-10(3)11(13-4)14-9-15-12/h9H,5-8H2,1-4H3,(H,13,14,15) |
| InChIKey | ZUMUOJXPSRANSE-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |