C13H19N3 — CID 102609041
5-(2,2,3-trimethylbutylamino)pyridine-2-carbonitrile (PubChem CID 102609041) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 5-(2,2,3-trimethylbutylamino)pyridine-2-carbonitrile.
| Compound Name | 5-(2,2,3-trimethylbutylamino)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 102609041 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 5-(2,2,3-trimethylbutylamino)pyridine-2-carbonitrile |
| SMILES | CC(C)C(C)(C)CNc1ccc(C#N)nc1 |
| InChI | InChI=1S/C13H19N3/c1-10(2)13(3,4)9-16-12-6-5-11(7-14)15-8-12/h5-6,8,10,16H,9H2,1-4H3 |
| InChIKey | ADYCYJILSRDSRN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |