C14H22N4 — CID 133334959
5-[[2-(dimethylamino)-4-methylpentyl]amino]pyridine-2-carbonitrile (PubChem CID 133334959) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 5-[[2-(dimethylamino)-4-methylpentyl]amino]pyridine-2-carbonitrile.
| Compound Name | 5-[[2-(dimethylamino)-4-methylpentyl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 133334959 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 5-[[2-(dimethylamino)-4-methylpentyl]amino]pyridine-2-carbonitrile |
| SMILES | CC(C)CC(CNc1ccc(C#N)nc1)N(C)C |
| InChI | InChI=1S/C14H22N4/c1-11(2)7-14(18(3)4)10-17-13-6-5-12(8-15)16-9-13/h5-6,9,11,14,17H,7,10H2,1-4H3 |
| InChIKey | JHWDNAVJUPCJDM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |