C10H17N3O3S — CID 102609491
N-(3-ethoxycyclobutyl)-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 102609491) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is N-(3-ethoxycyclobutyl)-2-methyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-(3-ethoxycyclobutyl)-2-methyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 102609491 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | N-(3-ethoxycyclobutyl)-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | CCOC1CC(NS(=O)(=O)c2cnc(C)[nH]2)C1 |
| InChI | InChI=1S/C10H17N3O3S/c1-3-16-9-4-8(5-9)13-17(14,15)10-6-11-7(2)12-10/h6,8-9,13H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | XAKPTKHNPFZWSR-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |