C10H19N3O2S — CID 103908379
2-methyl-N-(3-methylpentan-3-yl)-1H-imidazole-5-sulfonamide (PubChem CID 103908379) has the molecular formula C10H19N3O2S and a molecular weight of 245.35 g/mol. Its IUPAC name is 2-methyl-N-(3-methylpentan-3-yl)-1H-imidazole-5-sulfonamide.
| Compound Name | 2-methyl-N-(3-methylpentan-3-yl)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 103908379 |
| Molecular Formula | C10H19N3O2S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2-methyl-N-(3-methylpentan-3-yl)-1H-imidazole-5-sulfonamide |
| SMILES | CCC(C)(CC)NS(=O)(=O)c1cnc(C)[nH]1 |
| InChI | InChI=1S/C10H19N3O2S/c1-5-10(4,6-2)13-16(14,15)9-7-11-8(3)12-9/h7,13H,5-6H2,1-4H3,(H,11,12) |
| InChIKey | GIVHOESIKKDCMF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |