C9H8N2O — CID 10261369
4-oxo-1,5,6,7-tetrahydroindole-2-carbonitrile (PubChem CID 10261369) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 4-oxo-1,5,6,7-tetrahydroindole-2-carbonitrile.
| Compound Name | 4-oxo-1,5,6,7-tetrahydroindole-2-carbonitrile |
|---|---|
| PubChem CID | 10261369 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 4-oxo-1,5,6,7-tetrahydroindole-2-carbonitrile |
| SMILES | N#Cc1cc2c([nH]1)CCCC2=O |
| InChI | InChI=1S/C9H8N2O/c10-5-6-4-7-8(11-6)2-1-3-9(7)12/h4,11H,1-3H2 |
| InChIKey | YDQPTVNJPCWFCL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |