C12H10Br2N2O2 — CID 102614873
methyl 6,8-dibromo-4-(methylamino)quinoline-3-carboxylate (PubChem CID 102614873) has the molecular formula C12H10Br2N2O2 and a molecular weight of 374.03 g/mol. Its IUPAC name is methyl 6,8-dibromo-4-(methylamino)quinoline-3-carboxylate.
| Compound Name | methyl 6,8-dibromo-4-(methylamino)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 102614873 |
| Molecular Formula | C12H10Br2N2O2 |
| Molecular Weight | 374.03 g/mol |
| Exact Mass | 371.91 |
| IUPAC Name | methyl 6,8-dibromo-4-(methylamino)quinoline-3-carboxylate |
| SMILES | CNc1c(C(=O)OC)cnc2c(Br)cc(Br)cc12 |
| InChI | InChI=1S/C12H10Br2N2O2/c1-15-10-7-3-6(13)4-9(14)11(7)16-5-8(10)12(17)18-2/h3-5H,1-2H3,(H,15,16) |
| InChIKey | QQQKIGDGRZRNCL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.03 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |