C15H20ClFN2 — CID 102615523
N-[(2-chloro-5-fluorophenyl)methyl]-1-(1-cyclopropylpyrrolidin-3-yl)methanamine (PubChem CID 102615523) has the molecular formula C15H20ClFN2 and a molecular weight of 282.79 g/mol. Its IUPAC name is N-[(2-chloro-5-fluorophenyl)methyl]-1-(1-cyclopropylpyrrolidin-3-yl)methanamine.
| Compound Name | N-[(2-chloro-5-fluorophenyl)methyl]-1-(1-cyclopropylpyrrolidin-3-yl)methanamine |
|---|---|
| PubChem CID | 102615523 |
| Molecular Formula | C15H20ClFN2 |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | N-[(2-chloro-5-fluorophenyl)methyl]-1-(1-cyclopropylpyrrolidin-3-yl)methanamine |
| SMILES | Fc1ccc(Cl)c(CNCC2CCN(C3CC3)C2)c1 |
| InChI | InChI=1S/C15H20ClFN2/c16-15-4-1-13(17)7-12(15)9-18-8-11-5-6-19(10-11)14-2-3-14/h1,4,7,11,14,18H,2-3,5-6,8-10H2 |
| InChIKey | QIHLCLNIZTWDHN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |