C14H20ClFN2 — CID 102615607
N-[(2-chloro-5-fluorophenyl)methyl]-1-(1-methylpiperidin-4-yl)methanamine (PubChem CID 102615607) has the molecular formula C14H20ClFN2 and a molecular weight of 270.78 g/mol. Its IUPAC name is N-[(2-chloro-5-fluorophenyl)methyl]-1-(1-methylpiperidin-4-yl)methanamine.
| Compound Name | N-[(2-chloro-5-fluorophenyl)methyl]-1-(1-methylpiperidin-4-yl)methanamine |
|---|---|
| PubChem CID | 102615607 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-[(2-chloro-5-fluorophenyl)methyl]-1-(1-methylpiperidin-4-yl)methanamine |
| SMILES | CN1CCC(CNCc2cc(F)ccc2Cl)CC1 |
| InChI | InChI=1S/C14H20ClFN2/c1-18-6-4-11(5-7-18)9-17-10-12-8-13(16)2-3-14(12)15/h2-3,8,11,17H,4-7,9-10H2,1H3 |
| InChIKey | QOITUGHICQHOIN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |