C14H18FN3 — CID 107903932
4-fluoro-2-[[(1-methylpyrrolidin-3-yl)methylamino]methyl]benzonitrile (PubChem CID 107903932) has the molecular formula C14H18FN3 and a molecular weight of 247.32 g/mol. Its IUPAC name is 4-fluoro-2-[[(1-methylpyrrolidin-3-yl)methylamino]methyl]benzonitrile.
| Compound Name | 4-fluoro-2-[[(1-methylpyrrolidin-3-yl)methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107903932 |
| Molecular Formula | C14H18FN3 |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 4-fluoro-2-[[(1-methylpyrrolidin-3-yl)methylamino]methyl]benzonitrile |
| SMILES | CN1CCC(CNCc2cc(F)ccc2C#N)C1 |
| InChI | InChI=1S/C14H18FN3/c1-18-5-4-11(10-18)8-17-9-13-6-14(15)3-2-12(13)7-16/h2-3,6,11,17H,4-5,8-10H2,1H3 |
| InChIKey | FPXFTBRADUJGDA-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |