C11H13ClFNO2S — CID 102616235
methyl 2-amino-3-[(2-chloro-5-fluorophenyl)methylsulfanyl]propanoate (PubChem CID 102616235) has the molecular formula C11H13ClFNO2S and a molecular weight of 277.75 g/mol. Its IUPAC name is methyl 2-amino-3-[(2-chloro-5-fluorophenyl)methylsulfanyl]propanoate.
| Compound Name | methyl 2-amino-3-[(2-chloro-5-fluorophenyl)methylsulfanyl]propanoate |
|---|---|
| PubChem CID | 102616235 |
| Molecular Formula | C11H13ClFNO2S |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | methyl 2-amino-3-[(2-chloro-5-fluorophenyl)methylsulfanyl]propanoate |
| SMILES | COC(=O)C(N)CSCc1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H13ClFNO2S/c1-16-11(15)10(14)6-17-5-7-4-8(13)2-3-9(7)12/h2-4,10H,5-6,14H2,1H3 |
| InChIKey | FFDQNMVCOLQIQS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |