C11H11FN2O2S — CID 64769673
(2R)-2-amino-3-[(2-cyano-5-fluorophenyl)methylsulfanyl]propanoic acid (PubChem CID 64769673) has the molecular formula C11H11FN2O2S and a molecular weight of 254.29 g/mol. Its IUPAC name is (2R)-2-amino-3-[(2-cyano-5-fluorophenyl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[(2-cyano-5-fluorophenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 64769673 |
| Molecular Formula | C11H11FN2O2S |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | (2R)-2-amino-3-[(2-cyano-5-fluorophenyl)methylsulfanyl]propanoic acid |
| SMILES | N#Cc1ccc(F)cc1CSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H11FN2O2S/c12-9-2-1-7(4-13)8(3-9)5-17-6-10(14)11(15)16/h1-3,10H,5-6,14H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | CBEGSMXHIJHPRA-JTQLQIEISA-N |
| XLogP | 1.34 |
| TPSA | 87.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |