C10H11ClFNO2S — CID 102846920
(2R)-2-amino-3-[(3-chloro-2-fluorophenyl)methylsulfanyl]propanoic acid (PubChem CID 102846920) has the molecular formula C10H11ClFNO2S and a molecular weight of 263.72 g/mol. Its IUPAC name is (2R)-2-amino-3-[(3-chloro-2-fluorophenyl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-amino-3-[(3-chloro-2-fluorophenyl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 102846920 |
| Molecular Formula | C10H11ClFNO2S |
| Molecular Weight | 263.72 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | (2R)-2-amino-3-[(3-chloro-2-fluorophenyl)methylsulfanyl]propanoic acid |
| SMILES | N[C@@H](CSCc1cccc(Cl)c1F)C(=O)O |
| InChI | InChI=1S/C10H11ClFNO2S/c11-7-3-1-2-6(9(7)12)4-16-5-8(13)10(14)15/h1-3,8H,4-5,13H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | HCMYJIHCXBNODZ-QMMMGPOBSA-N |
| XLogP | 2.12 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.72 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |