C5H7BrN2OS — CID 102617953
5-bromo-3-(2-methoxyethyl)-1,2,4-thiadiazole (PubChem CID 102617953) has the molecular formula C5H7BrN2OS and a molecular weight of 223.09 g/mol. Its IUPAC name is 5-bromo-3-(2-methoxyethyl)-1,2,4-thiadiazole.
| Compound Name | 5-bromo-3-(2-methoxyethyl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102617953 |
| Molecular Formula | C5H7BrN2OS |
| Molecular Weight | 223.09 g/mol |
| Exact Mass | 221.95 |
| IUPAC Name | 5-bromo-3-(2-methoxyethyl)-1,2,4-thiadiazole |
| SMILES | COCCc1nsc(Br)n1 |
| InChI | InChI=1S/C5H7BrN2OS/c1-9-3-2-4-7-5(6)10-8-4/h2-3H2,1H3 |
| InChIKey | YLHRINJOMGGQFU-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.09 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |