C5H8N2OS — CID 119096458
5-ethoxy-3-methyl-1,2,4-thiadiazole (PubChem CID 119096458) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is 5-ethoxy-3-methyl-1,2,4-thiadiazole.
| Compound Name | 5-ethoxy-3-methyl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 119096458 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 5-ethoxy-3-methyl-1,2,4-thiadiazole |
| SMILES | CCOc1nc(C)ns1 |
| InChI | InChI=1S/C5H8N2OS/c1-3-8-5-6-4(2)7-9-5/h3H2,1-2H3 |
| InChIKey | OZESJFHKFZYHEB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |