C7H9BrN2OS — CID 102618072
5-bromo-3-(oxan-4-yl)-1,2,4-thiadiazole (PubChem CID 102618072) has the molecular formula C7H9BrN2OS and a molecular weight of 249.13 g/mol. Its IUPAC name is 5-bromo-3-(oxan-4-yl)-1,2,4-thiadiazole.
| Compound Name | 5-bromo-3-(oxan-4-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618072 |
| Molecular Formula | C7H9BrN2OS |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 5-bromo-3-(oxan-4-yl)-1,2,4-thiadiazole |
| SMILES | Brc1nc(C2CCOCC2)ns1 |
| InChI | InChI=1S/C7H9BrN2OS/c8-7-9-6(10-12-7)5-1-3-11-4-2-5/h5H,1-4H2 |
| InChIKey | LRYAHUCLIOYFJA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |