C11H17IN2OS — CID 102618351
3-(1-ethoxy-4-methylcyclohexyl)-5-iodo-1,2,4-thiadiazole (PubChem CID 102618351) has the molecular formula C11H17IN2OS and a molecular weight of 352.24 g/mol. Its IUPAC name is 3-(1-ethoxy-4-methylcyclohexyl)-5-iodo-1,2,4-thiadiazole.
| Compound Name | 3-(1-ethoxy-4-methylcyclohexyl)-5-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618351 |
| Molecular Formula | C11H17IN2OS |
| Molecular Weight | 352.24 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 3-(1-ethoxy-4-methylcyclohexyl)-5-iodo-1,2,4-thiadiazole |
| SMILES | CCOC1(c2nsc(I)n2)CCC(C)CC1 |
| InChI | InChI=1S/C11H17IN2OS/c1-3-15-11(6-4-8(2)5-7-11)9-13-10(12)16-14-9/h8H,3-7H2,1-2H3 |
| InChIKey | XAKJXIONYUEOAQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|