C10H6F3IN2S — CID 102618418
5-iodo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-thiadiazole (PubChem CID 102618418) has the molecular formula C10H6F3IN2S and a molecular weight of 370.14 g/mol. Its IUPAC name is 5-iodo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-thiadiazole.
| Compound Name | 5-iodo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618418 |
| Molecular Formula | C10H6F3IN2S |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 5-iodo-3-[[3-(trifluoromethyl)phenyl]methyl]-1,2,4-thiadiazole |
| SMILES | FC(F)(F)c1cccc(Cc2nsc(I)n2)c1 |
| InChI | InChI=1S/C10H6F3IN2S/c11-10(12,13)7-3-1-2-6(4-7)5-8-15-9(14)17-16-8/h1-4H,5H2 |
| InChIKey | WHTCJZJEDUHEPG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|