C12H6Cl2F3IN2 — CID 66316212
4,6-dichloro-5-iodo-2-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine (PubChem CID 66316212) has the molecular formula C12H6Cl2F3IN2 and a molecular weight of 433.00 g/mol. Its IUPAC name is 4,6-dichloro-5-iodo-2-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine.
| Compound Name | 4,6-dichloro-5-iodo-2-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine |
|---|---|
| PubChem CID | 66316212 |
| Molecular Formula | C12H6Cl2F3IN2 |
| Molecular Weight | 433.00 g/mol |
| Exact Mass | 431.89 |
| IUPAC Name | 4,6-dichloro-5-iodo-2-[[3-(trifluoromethyl)phenyl]methyl]pyrimidine |
| SMILES | FC(F)(F)c1cccc(Cc2nc(Cl)c(I)c(Cl)n2)c1 |
| InChI | InChI=1S/C12H6Cl2F3IN2/c13-10-9(18)11(14)20-8(19-10)5-6-2-1-3-7(4-6)12(15,16)17/h1-4H,5H2 |
| InChIKey | ZXILFXGODAHFIJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.00 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|