C6H7IN2OS — CID 102618612
5-iodo-3-(oxolan-3-yl)-1,2,4-thiadiazole (PubChem CID 102618612) has the molecular formula C6H7IN2OS and a molecular weight of 282.11 g/mol. Its IUPAC name is 5-iodo-3-(oxolan-3-yl)-1,2,4-thiadiazole.
| Compound Name | 5-iodo-3-(oxolan-3-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618612 |
| Molecular Formula | C6H7IN2OS |
| Molecular Weight | 282.11 g/mol |
| Exact Mass | 281.93 |
| IUPAC Name | 5-iodo-3-(oxolan-3-yl)-1,2,4-thiadiazole |
| SMILES | Ic1nc(C2CCOC2)ns1 |
| InChI | InChI=1S/C6H7IN2OS/c7-6-8-5(9-11-6)4-1-2-10-3-4/h4H,1-3H2 |
| InChIKey | RBLJAYTVYBTQIR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.11 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|