C9H14N2OS — CID 155227232
3-(oxolan-3-yl)-5-propan-2-yl-1,2,4-thiadiazole (PubChem CID 155227232) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 3-(oxolan-3-yl)-5-propan-2-yl-1,2,4-thiadiazole.
| Compound Name | 3-(oxolan-3-yl)-5-propan-2-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 155227232 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-(oxolan-3-yl)-5-propan-2-yl-1,2,4-thiadiazole |
| SMILES | CC(C)c1nc(C2CCOC2)ns1 |
| InChI | InChI=1S/C9H14N2OS/c1-6(2)9-10-8(11-13-9)7-3-4-12-5-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | LNLISJXAENNCHQ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |