C8H12N2O2S2 — CID 150380361
3-(methoxymethylsulfanyl)-5-(oxolan-3-yl)-1,2,4-thiadiazole (PubChem CID 150380361) has the molecular formula C8H12N2O2S2 and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-(methoxymethylsulfanyl)-5-(oxolan-3-yl)-1,2,4-thiadiazole.
| Compound Name | 3-(methoxymethylsulfanyl)-5-(oxolan-3-yl)-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 150380361 |
| Molecular Formula | C8H12N2O2S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 3-(methoxymethylsulfanyl)-5-(oxolan-3-yl)-1,2,4-thiadiazole |
| SMILES | COCSc1nsc(C2CCOC2)n1 |
| InChI | InChI=1S/C8H12N2O2S2/c1-11-5-13-8-9-7(14-10-8)6-2-3-12-4-6/h6H,2-5H2,1H3 |
| InChIKey | GZPIOTMMRZAYFZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|