C9H6BrIN2S2 — CID 102618710
3-[(2-bromophenyl)sulfanylmethyl]-5-iodo-1,2,4-thiadiazole (PubChem CID 102618710) has the molecular formula C9H6BrIN2S2 and a molecular weight of 413.10 g/mol. Its IUPAC name is 3-[(2-bromophenyl)sulfanylmethyl]-5-iodo-1,2,4-thiadiazole.
| Compound Name | 3-[(2-bromophenyl)sulfanylmethyl]-5-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102618710 |
| Molecular Formula | C9H6BrIN2S2 |
| Molecular Weight | 413.10 g/mol |
| Exact Mass | 411.82 |
| IUPAC Name | 3-[(2-bromophenyl)sulfanylmethyl]-5-iodo-1,2,4-thiadiazole |
| SMILES | Brc1ccccc1SCc1nsc(I)n1 |
| InChI | InChI=1S/C9H6BrIN2S2/c10-6-3-1-2-4-7(6)14-5-8-12-9(11)15-13-8/h1-4H,5H2 |
| InChIKey | BFZHOCQBEIMMGL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.10 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|