C17H21ClFN — CID 102619984
N-[[3-[(2-chloro-5-fluorophenyl)methyl]-3-bicyclo[3.1.0]hexanyl]methyl]cyclopropanamine (PubChem CID 102619984) has the molecular formula C17H21ClFN and a molecular weight of 293.81 g/mol. Its IUPAC name is N-[[3-[(2-chloro-5-fluorophenyl)methyl]-3-bicyclo[3.1.0]hexanyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-[(2-chloro-5-fluorophenyl)methyl]-3-bicyclo[3.1.0]hexanyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 102619984 |
| Molecular Formula | C17H21ClFN |
| Molecular Weight | 293.81 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | N-[[3-[(2-chloro-5-fluorophenyl)methyl]-3-bicyclo[3.1.0]hexanyl]methyl]cyclopropanamine |
| SMILES | Fc1ccc(Cl)c(CC2(CNC3CC3)CC3CC3C2)c1 |
| InChI | InChI=1S/C17H21ClFN/c18-16-4-1-14(19)6-13(16)9-17(10-20-15-2-3-15)7-11-5-12(11)8-17/h1,4,6,11-12,15,20H,2-3,5,7-10H2 |
| InChIKey | UMZXYKFJUXILOA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.81 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |